AzNetworkDiagram.psm1
<#
.SYNOPSIS Creates a Network Diagram of your Azure networking infrastructure. .DESCRIPTION The Get-AzNetworkDiagram.ps1 visualizes Azure networking utilizing GraphViz and the "DOT", diagram-as-code language to export a PNG and PDF with a network digram containing: - VNets, including: - VNet peerings - Subnets (will be marked with an "#" if a Network Security Group is associated) - Special subnets - AzureBastionSubnet, GatewaySubnet, AzureFirewallSubnet - Associated Route Tables - Gateways - VPN incl. associated Local Network Gateways and static remote subnets - ER (excl. connected cicuits!) IMPORTANT: Icons in the .\icons\ folder is necessary in order to generate the diagram. If not present, they will be downloaded to current working during runtime. .PARAMETER OutputPath Specifies the path for the DOT-based output file. If unset - current working directory will be used. .INPUTS None. It will however require previous authentication to Azure .OUTPUTS None. .\Get-AzNetworkDiagram.psm1 doesn't generate any output (Powershell-wise). FIle based out will be save in the OutputPath .EXAMPLE # Import module (will be available on PSGallary shortly) PS> Import-Module .\AzNetworkDiagram.psm1 # Run PS> .\Get-AzNetworkDiagram [-outputPath C:\temp\] PS> .\Get-AzNetworkDiagram .LINK https://github.com/dan-madsen/AzNetworkDiagram #> # Change Execution Policy for current process, if prohibited by policy # Set-ExecutionPolicy -scope process -ExecutionPolicy bypass ##### Global runtime vars ##### #Rank (visual) in diagram $global:rankrts = @() #$global:ranksubnets = @() $global:rankvnetaddressspaces = @() ##### Functions for standard definitions ##### function Export-dotHeader { $Data = "digraph G { fontname=`"Arial,sans-serif`" node [fontname=`"Arial,sans-serif`"] edge [fontname=`"Arial,sans-serif`"] # Ability fot peerings arrows/connections to end at border compound = true; # Rank (height in picture) support newrank = true; rankdir = TB; " Export-CreateFile -Data $Data } function Export-dotFooter { Export-AddToFile -Data "`n ##########################################################################################################" Export-AddToFile -Data " ##### RANKS" Export-AddToFile -Data " ##########################################################################################################`n" Export-AddToFile -Data " ### AddressSpace ranks" $rankvnetaddressspacesdata = " { rank=same; " $global:rankvnetaddressspaces | ForEach-Object { $vnetaddresspacename = $_ $rankvnetaddressspacesdata += $vnetaddresspacename + "; "; } Export-AddToFile -Data "$rankvnetaddressspacesdata }" Export-AddToFile -Data "`n ### Subnets ranks (TODO!)" Export-AddToFile -Data "`n ### Route table ranks" $rankroutedata = " { rank=same; " $rankrts | ForEach-Object { $routename = $_ $rankroutedata += $routename + "; "; } Export-AddToFile -Data "$rankroutedata }" Export-AddToFile -Data "}" #EOF } function Export-CreateFile { param([string]$Data) $Data | Out-File -Encoding ASCII $OutputPath\AzNetworkDiagram.dot } function Export-AddToFile { param([string]$Data) $Data | Out-File -Encoding ASCII -Append $OutputPath\AzNetworkDiagram.dot } function Export-SubnetConfig { Param ( [Parameter(Mandatory = $true, Position = 0)] [PSCustomObject[]] $subnetconfig ) $data = "" #Loop over subnets $subnetconfig | ForEach-Object { $subnetconfigobject = $_ $id = $_.id.replace("-", "").replace("/", "").replace(".", "").ToLower() # NSG $nsgid = $_.NetworkSecurityGroupText.ToLower() if ($nsgid -ne "null") { $nsgid = ($_.NetworkSecurityGroupText | ConvertFrom-Json).id.replace("-", "").replace("/", "").replace(".", "").ToLower() } # Route Table $routetableid = $_.RouteTableText.ToLower() if ($routetableid -ne "null" ) { $routetableid = (($_.RouteTableText | ConvertFrom-Json).id).replace("-", "").replace("/", "").replace(".", "").ToLower() } # Name $name = $_.Name if ( $nsgid -ne "null") { $name += " #" } # vNet $vnetid = $_.id $vnetid = $vnetid -split "/subnets/" $vnetid = $vnetid[0].replace("-", "").replace("/", "").replace(".", "").ToLower() # AddressPrefix $AddressPrefix = $_.AddressPrefix # Support for different types of subnets (AzFW, Bastion etc.) # DOT switch ($name) { "AzureFirewallSubnet" { $AzFW = $subnetconfigobject.IpConfigurationsText | ConvertFrom-Json if ($AzFW -ne "[]") { $AzFWid = (($AzFW.id -split ("/azureFirewallIpConfigurations/"))[0]).replace("-", "").replace("/", "").replace(".", "").ToLower() $AzFWname = $AzFW.id.split("/")[8].ToLower() $AzFWrg = $AzFW.id.split("/")[4] $AzFWobject = Get-AzFirewall -Name $AzFWname -ResourceGroupName $AzFWrg $AzFWpolicyName = $AzFWobject.FirewallPolicy.id.split("/")[8] #Private IPs $AzFWPrivateIP = ($AzFWobject.IpConfigurationsText | ConvertFrom-Json).privateIPaddress #Public IPs $AzFWPublicIPsArray = ($AzFWobject.IpConfigurationsText | ConvertFrom-Json).PublicIpAddress $AzFWPublicIPs = "" $AzFWPublicIPsArray.id | ForEach-Object { $rgname = $_.split("/")[4] $ipname = $_.split("/")[8] $publicip = (Get-AzPublicIpAddress -ResourceName $ipname -ResourceGroupName $rgname).IpAddress $AzFWPublicIPs += "$ipname : $publicip \n" } $data = $data + " $id [label = `"\n$name\n$AddressPrefix\n\nName: $AzFWname\nPolicy name: $AzFWpolicyName\n\nPrivate IP:$AzFWPrivateIP\n\nPublic IP(s):\n$AzFWPublicIPs`" ; color = lightgray;image = `"$OutputPath\icons\afw.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" } else { $data = $data + " $id [label = `"\n$name\n$AddressPrefix`" ; color = lightgray;image = `"$OutputPath\icons\afw.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" #Write-Output $data } } "AzureBastionSubnet" { $AzBastionName = $subnetconfigobject.IpConfigurationsText | ConvertFrom-Json if ($AzBastionName -ne "[]") { $AzBastionName = ($subnetconfigobject.IpConfigurationsText | ConvertFrom-Json).id.split("/")[8] } $AzBastionName = $AzBastionName.ToLower() $data = $data + " $id [label = `"\n\n$name\n$AddressPrefix\nName: $AzBastionName`" ; color = lightgray;image = `"$OutputPath\icons\bas.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" } "GatewaySubnet" { $data = $data + " $id [label = `"\n\n$name\n$AddressPrefix`" ; color = lightgray;image = `"$OutputPath\icons\vgw.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" $data += "`n" #GW DOT if ($subnetconfigobject.IpConfigurationsText -ne "[]" ) { $gws = $subnetconfigobject.IpConfigurationsText | ConvertFrom-Json #Multi GW scenearios $gws | ForEach-Object { $gwid = (($_.id -split ("/ipConfigurations/"))[0]).replace("-", "").replace("/", "").replace(".", "").ToLower() $gwname = ($_.id-split "/").split("/")[8].ToLower() $gwrg = ($_.id -split "/").split("/")[4] $gw = Get-AzVirtualNetworkGateway -ResourceGroupName $gwrg -ResourceName $gwname $gwtype = $gw.Gatewaytype # ER vs VPN GWs are handled differently if ($gwtype -eq "Vpn" ) { $gwipobjetcs = $gw.IpConfigurations.PublicIpAddress $gwips = "" $gwipobjetcs.id | ForEach-Object { $rgname = $_.split("/")[4] $ipname = $_.split("/")[8] $publicip = (Get-AzPublicIpAddress -ResourceName $ipname -ResourceGroupName $rgname).IpAddress $gwips += "$ipname : $publicip \n" } $data += " $gwid [color = lightgray;label = `"\n\nName: $gwname`\n\nPublic IP(s):\n$gwips`";image = `"$OutputPath\icons\vgw.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" } elseif ($gwtype -eq "ExpressRoute") { $data += " $gwid [color = lightgray;label = `"\nName: $gwname`";image = `"$OutputPath\icons\ergw.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" } $data += "`n" $data += " $id -> $gwid" $data += "`n" } } } default { $data = $data + " $id [label = `"\n$name\n$AddressPrefix`" ; color = lightgray;image = `"$OutputPath\icons\snet.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" } } $data += "`n" # DOT $data = $data + " $vnetid -> $id" $data += "`n" if ($routetableid -ne "null" ) { # DOT $data += "$id -> $routetableid" + "`n" } #NATGW if ( $null -ne $subnetconfigobject.NatGateway ) { #Define NAT GW $NATGWID = $subnetconfigobject.NatGateway.id.replace("-", "").replace("/", "").replace(".", "").ToLower() $name = $subnetconfigobject.NatGateway.id.split("/")[8] $rg = $subnetconfigobject.NatGateway.id.split("/")[4] $NATGWobject = Get-AzNatGateway -Name $name -ResourceGroupName $rg #Public IPs associated $ips = $NATGWobject.PublicIpAddresses $ipsstring = "" $ips.id | ForEach-Object { $rgname = $_.split("/")[4] $ipname = $_.split("/")[8] $publicip = (Get-AzPublicIpAddress -ResourceName $ipname -ResourceGroupName $rgname).IpAddress $ipsstring += "$ipname : $publicip \n" } #Public IP prefixes associated $ipprefixes = $NATGWobject.PublicIpPrefixes $ipprefixesstring = "" $ipprefixes.id | ForEach-Object { $rgname = $_.split("/")[4] $ipname = $_.split("/")[8] $prefix = (Get-AzPublicIpPrefix -ResourceName $ipname -ResourceGroupName $rgname).IPPrefix $ipprefixesstring += "$ipname : $prefix \n" } $data += "$NATGWID [color = lightgrey;label = `"\n\nName: $name\n\nPublic IP(s):\n$ipsstring\nPublic IP Prefix(es):\n$ipprefixesstring`";image = `"$OutputPath\icons\ng.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" $data += "$id -> $NATGWID" + "`n" } } return $data } function Export-vnet { param ([PSCustomObject[]]$vnet) $vnetname = $vnet.Name $id = $vnet.id.replace("-", "").replace("/", "").replace(".", "").ToLower() $vnetAddressSpaces = $vnet.AddressSpace.AddressPrefixes $subnetconfig = $vnet | Get-AzVirtualNetworkSubnetConfig $global:rankvnetaddressspaces += $id $header = " # $vnetname - $id subgraph cluster_$id { style = solid; color = black; node [color = white;]; " # Convert addressSpace prefixes from array to string $vnetAddressSpacesString = "" $vnetAddressSpaces | ForEach-Object { $vnetAddressSpacesString = $vnetAddressSpacesString + $_ + "\n" } $vnetdata = " $id [color = lightgray;label = `"\nAddress Space(s):\n$vnetAddressSpacesString`";image = `"$OutputPath\icons\vnet.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];`n" # Subnets if ($subnetconfig) { $subnetdata = Export-SubnetConfig $subnetconfig } $footer = " label = `"$vnetname`"; } " $alldata = $header + $vnetdata + $subnetdata + $footer Export-AddToFile -Data $alldata # Peerings $vnetPeerings = $vnet.VirtualNetworkPeerings.RemoteVirtualNetworkText if ($vnetPeerings) { $vnetPeerings = $vnet.VirtualNetworkPeerings.RemoteVirtualNetworkText | ConvertFrom-Json $vnetPeerings | ForEach-Object { $peering = $_.id.replace("-", "").replace("/", "").replace(".", "").ToLower() # DOT $data = "$id -> $peering [ltail = cluster_$id; lhead = cluster_$peering;];" Export-AddToFile -Data $data } } } function Export-RouteTable { param ([PSCustomObject[]]$routetable) $routetableName = $routetable.Name $id = $routetable.id.replace("-", "").replace("/", "").replace(".", "").ToLower() $global:rankrts += $id $header = " subgraph cluster_$id { style = solid; color = black; $id [shape = none;label = < <TABLE border=`"1`" style=`"rounded`"> <TR><TD colspan=`"3`" border=`"0`">$routetableName</TD></TR> <TR><TD>Route</TD><TD>NextHopType</TD><TD>NextHopIpAddress</TD></TR> " # Individual Routes $data = "" $routetable.Routes | ForEach-Object { $route = $_ $addressprefix = $route.AddressPrefix $nexthoptype = $route.NextHopType $nexthopip = $route.NextHopIpAddress $data = $data + "<TR><TD>$addressprefix</TD><TD>$nexthoptype</TD><TD>$nexthopip</TD></TR>" } # End table $footer = " </TABLE>>; ]; } " $alldata = $header + $data + $footer Export-AddToFile -Data $alldata } function Export-VPNConnection { param ([PSCustomObject[]]$connection) $name = $connection.Name $lgwid = $connection.LocalNetworkGateway2Text.replace("-", "").replace("/", "").replace(".", "").replace("`"", "").ToLower() $vpngwid = $connection.VirtualNetworkGateway1Text.replace("-", "").replace("/", "").replace(".", "").replace("`"", "").ToLower() $data = "" $lgwname = $connection.LocalNetworkGateway2Text.split("/")[8].replace("/", "").replace(".", "").replace("`"", "").ToLower() $lgwrg = $connection.LocalNetworkGateway2Text.split("/")[4].replace("/", "").replace(".", "").replace("`"", "").ToLower() $lgwconnectionname = $name $lgwobject = (Get-AzLocalNetworkGateway -ResourceGroupName $lgwrg -name $lgwname) $lgwip = $lgwobject.GatewayIpAddress $lgwsubnetsarray = $lgwobject.addressSpaceText | ConvertFrom-Json $lgwsubnets = "" $lgwsubnetsarray.AddressPrefixes | ForEach-Object { $prefix = $_ $lgwsubnets += "$prefix \n" } #DOT $data += "$lgwid [color = lightgrey;label = `"\n\nLocal GW: $lgwname\nConnection Name: $lgwconnectionname\nPeer IP:$lgwip\n\nStatic remote subnet(s):\n$lgwsubnets`";image = `"$OutputPath\icons\lgw.png`";imagepos = `"tc`";labelloc = `"b`";height = 1.5;];" $data += "$vpngwid -> $lgwid" Export-AddToFile -Data $data } function Confirm-Prerequisites { $ErrorActionPreference = "Stop" if (! (Test-Path $OutputPath)) {} # dot.exe executable try { $dot = (get-command dot.exe).Path } catch { Write-Output "dot executable not found - please install Graphiz (https://graphviz.org), and/or ensure `"dot.exe` is in `"`$PATH`" !" return } # Load Powershell modules try { import-module az.network -DisableNameChecking import-module az.accounts } catch { Write-Output "Please install the following PowerShell modules, using install-module: Az.Network + Az.Accounts" return } # Azure authentication verification $context = Get-AzContext if ($null -eq $context) { Write-Output "Please make sure you are logged in to Azure using Login-AzAccount, and that permissions are granted to resources within scope." Write-Output "A login window should appear - hint: they may hide behind active windows!" Login-AzAccount return } # Icons available? if (! (Test-Path "$OutputPath\icons") ) { Write-Output "Downloading icons to $OutputPath\icons\ ... " ; New-Item -Path "$OutputPath" -Name "icons" -ItemType "directory" | Out-null } $icons = @( "afw.png", "bas.png", "ergw.png", "lgw.png", "LICENSE", "ng.png", "snet.png", "vgw.png", "vnet.png" ) $icons | ForEach-Object { if (! (Test-Path "$OutputPath\icons\$_") ) { Invoke-WebRequest "https://github.com/dan-madsen/AzNetworkDiagram/raw/refs/heads/main/icons/$_" -OutFile "$OutputPath\icons\$_" } } } function Get-AzNetworkDiagram { # Parameters param ( [string]$OutputPath = $pwd, [string[]]$Subscriptions ) # Reset global vars $global:rankrts = @() #$global:ranksubnets = @() $global:rankvnetaddressspaces = @() Write-Output "Checking prerequisites ..." Confirm-Prerequisites Write-Output "Gathering information ..." ##### Data collection / Execution ##### # Run program and collect data through powershell commands Export-dotHeader # Set subscriptions to every accessible subscription, if unset if ( $null -eq $Subscriptions ) { $Subscriptions = (Get-AzSubscription).Id } $Subscriptions | ForEach-Object { # Set Context $context = $_ Set-AzContext $context | Out-null $subname = (Get-AzContext).Subscription.Name Export-AddToFile "`n ##########################################################################################################" Export-AddToFile " ##### $subname " Export-AddToFile " ##########################################################################################################`n" ### RTs Export-AddToFile " ##### $subname - Route Tables #####" $routetables = Get-AzRouteTable | Where-Object { ($_.SubnetsText -ne "[]") } $routetables | ForEach-Object { $routetable = $_ Export-RouteTable $routetable } ### vNets (incl. subnets) Export-AddToFile " ##### $subname - Virtual Networks #####" $vnets = Get-AzVirtualNetwork $vnets | ForEach-Object { $vnet = $_ Export-vnet $vnet } #VPN Connections Export-AddToFile " ##### $subname - VPN Connections #####" $VPNConnections = Get-AzResource | Where-Object { $_.ResourceType -eq "Microsoft.Network/connections" } #$VPNConnections = Get- | Where-Object { ($_. -ne "[]")} $VPNConnections | ForEach-Object { $connection = $_ $resname = $connection.Name $rgname = $connection.ResourceGroupName $connection = Get-AzVirtualNetworkGatewayConnection -name $resname -ResourceGroupName $rgname Export-VPNConnection $connection } } Export-dotFooter ##### Generate diagram ##### # Generate diagram using Graphviz Write-Output "Generating $OutputPath\AzNetworkDiagram.pdf ..." dot -Tpdf $OutputPath\AzNetworkDiagram.dot -o $OutputPath\AzNetworkDiagram.pdf Write-Output "Generating $OutputPath\AzNetworkDiagram.png ..." dot -Tpng $OutputPath\AzNetworkDiagram.dot -o $OutputPath\AzNetworkDiagram.png } Export-ModuleMember -Function Get-AzNetworkDiagram |